C26H29N5O3 — CID 58441002
4-butoxy-N-[1-(2-methyl-1-oxo-3,4-dihydroisoquinolin-6-yl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-yl]benzamide (PubChem CID 58441002) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-butoxy-N-[1-(2-methyl-1-oxo-3,4-dihydroisoquinolin-6-yl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-yl]benzamide.
| Compound Name | 4-butoxy-N-[1-(2-methyl-1-oxo-3,4-dihydroisoquinolin-6-yl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-yl]benzamide |
|---|---|
| PubChem CID | 58441002 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 4-butoxy-N-[1-(2-methyl-1-oxo-3,4-dihydroisoquinolin-6-yl)-2,3-dihydroimidazo[2,1-e]pyrazol-6-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc3n(n2)CCN3c2ccc3c(c2)CCN(C)C3=O)cc1 |
| InChI | InChI=1S/C26H29N5O3/c1-3-4-15-34-21-8-5-18(6-9-21)25(32)27-23-17-24-30(13-14-31(24)28-23)20-7-10-22-19(16-20)11-12-29(2)26(22)33/h5-10,16-17H,3-4,11-15H2,1-2H3,(H,27,28,32) |
| InChIKey | GUKDRHWLVHHSBE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|