C12H12N4 — CID 58443086
[5-(7H-cyclopenta[b]pyridin-5-yl)-1H-imidazol-2-yl]methanamine (PubChem CID 58443086) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is [5-(7H-cyclopenta[b]pyridin-5-yl)-1H-imidazol-2-yl]methanamine.
| Compound Name | [5-(7H-cyclopenta[b]pyridin-5-yl)-1H-imidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 58443086 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [5-(7H-cyclopenta[b]pyridin-5-yl)-1H-imidazol-2-yl]methanamine |
| SMILES | NCc1ncc(C2=CCc3ncccc32)[nH]1 |
| InChI | InChI=1S/C12H12N4/c13-6-12-15-7-11(16-12)9-3-4-10-8(9)2-1-5-14-10/h1-3,5,7H,4,6,13H2,(H,15,16) |
| InChIKey | IHDOBHUEBWOVTO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |