C27H30N2O3 — CID 58445787
N-[2-hydroxy-5-methyl-4-[[2-methyl-3-(4-methylphenyl)propanoyl]amino]phenyl]-3,4-dimethylbenzamide (PubChem CID 58445787) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-hydroxy-5-methyl-4-[[2-methyl-3-(4-methylphenyl)propanoyl]amino]phenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-hydroxy-5-methyl-4-[[2-methyl-3-(4-methylphenyl)propanoyl]amino]phenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 58445787 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[2-hydroxy-5-methyl-4-[[2-methyl-3-(4-methylphenyl)propanoyl]amino]phenyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(CC(C)C(=O)Nc2cc(O)c(NC(=O)c3ccc(C)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-16-6-9-21(10-7-16)12-20(5)26(31)28-23-15-25(30)24(14-19(23)4)29-27(32)22-11-8-17(2)18(3)13-22/h6-11,13-15,20,30H,12H2,1-5H3,(H,28,31)(H,29,32) |
| InChIKey | VVICDVLUPBSIKC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|