About dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide
dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide (PubChem CID 58446045) has the molecular formula C7H14MoNO4-
and a molecular weight of 272.13 g/mol. Its IUPAC name is dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide.
Molecular Properties
| Compound Name | dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide |
| PubChem CID | 58446045 |
| Molecular Formula | C7H14MoNO4- |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide |
| SMILES | O=[Mo]=O.[CH2-]CCN(CCO)C(C)=O |
| InChI | InChI=1S/C7H14NO2.Mo.2O/c1-3-4-8(5-6-9)7(2)10;;;/h9H,1,3-6H2,2H3;;;/q-1;;; |
| InChIKey | XPHYVGJKHNNYDT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide?
The IUPAC name of dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide (CID 58446045) is dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide.
What is the SMILES notation for dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide?
The canonical SMILES for dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide is O=[Mo]=O.[CH2-]CCN(CCO)C(C)=O.
What is the InChIKey of dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide?
The InChIKey is XPHYVGJKHNNYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO2.Mo.2O/c1-3-4-8(5-6-9)7(2)10;;;/h9H,1,3-6H2,2H3;;;/q-1;;;.
What are the key properties of dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide?
dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide has a molecular weight of 272.13 g/mol, XLogP of -0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomolybdenum;N-(2-hydroxyethyl)-N-propylacetamide is sourced from PubChem (CID 58446045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).