C12H22N2O4 — CID 175383713
N,N-bis(2-hydroxyethyl)-2-methylprop-2-enamide;2-methylprop-2-enamide (PubChem CID 175383713) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-methylprop-2-enamide;2-methylprop-2-enamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-methylprop-2-enamide;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 175383713 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-methylprop-2-enamide;2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCO)CCO.C=C(C)C(N)=O |
| InChI | InChI=1S/C8H15NO3.C4H7NO/c1-7(2)8(12)9(3-5-10)4-6-11;1-3(2)4(5)6/h10-11H,1,3-6H2,2H3;1H2,2H3,(H2,5,6) |
| InChIKey | KOUQKUAYZCALIB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|