C17H9ClF4N2O2 — CID 58447327
4-chloro-6-[2-[2-fluoro-5-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one (PubChem CID 58447327) has the molecular formula C17H9ClF4N2O2 and a molecular weight of 384.72 g/mol. Its IUPAC name is 4-chloro-6-[2-[2-fluoro-5-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one.
| Compound Name | 4-chloro-6-[2-[2-fluoro-5-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 58447327 |
| Molecular Formula | C17H9ClF4N2O2 |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 4-chloro-6-[2-[2-fluoro-5-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one |
| SMILES | O=C(Cc1cc(C(F)(F)F)ccc1F)c1ccc2c(=O)[nH]nc(Cl)c2c1 |
| InChI | InChI=1S/C17H9ClF4N2O2/c18-15-12-6-8(1-3-11(12)16(26)24-23-15)14(25)7-9-5-10(17(20,21)22)2-4-13(9)19/h1-6H,7H2,(H,24,26) |
| InChIKey | NUHZJNLXZGOEQV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |