C23H15F3N2O2 — CID 58447329
4-phenyl-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one (PubChem CID 58447329) has the molecular formula C23H15F3N2O2 and a molecular weight of 408.38 g/mol. Its IUPAC name is 4-phenyl-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one.
| Compound Name | 4-phenyl-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 58447329 |
| Molecular Formula | C23H15F3N2O2 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 4-phenyl-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-2H-phthalazin-1-one |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)c1ccc2c(=O)[nH]nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H15F3N2O2/c24-23(25,26)17-8-4-5-14(11-17)12-20(29)16-9-10-18-19(13-16)21(27-28-22(18)30)15-6-2-1-3-7-15/h1-11,13H,12H2,(H,28,30) |
| InChIKey | KKPUXTZUBPDBGA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |