C12H24O5S2 — CID 584524
4,4-bis(ethylsulfanyl)-1-(2-methyl-1,3-dioxolan-4-yl)butane-1,2,3-triol (PubChem CID 584524) has the molecular formula C12H24O5S2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4,4-bis(ethylsulfanyl)-1-(2-methyl-1,3-dioxolan-4-yl)butane-1,2,3-triol.
| Compound Name | 4,4-bis(ethylsulfanyl)-1-(2-methyl-1,3-dioxolan-4-yl)butane-1,2,3-triol |
|---|---|
| PubChem CID | 584524 |
| Molecular Formula | C12H24O5S2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4,4-bis(ethylsulfanyl)-1-(2-methyl-1,3-dioxolan-4-yl)butane-1,2,3-triol |
| SMILES | CCSC(SCC)C(O)C(O)C(O)C1COC(C)O1 |
| InChI | InChI=1S/C12H24O5S2/c1-4-18-12(19-5-2)11(15)10(14)9(13)8-6-16-7(3)17-8/h7-15H,4-6H2,1-3H3 |
| InChIKey | GIWSBFNFWMYTMG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|