C10H16N2O4 — CID 58454461
N-[1,2-dimethoxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide (PubChem CID 58454461) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-[1,2-dimethoxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide.
| Compound Name | N-[1,2-dimethoxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 58454461 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-[1,2-dimethoxy-2-(prop-2-enoylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(OC)C(NC(=O)C=C)OC |
| InChI | InChI=1S/C10H16N2O4/c1-5-7(13)11-9(15-3)10(16-4)12-8(14)6-2/h5-6,9-10H,1-2H2,3-4H3,(H,11,13)(H,12,14) |
| InChIKey | NWYICFASANNAHF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|