About [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate
[5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate (PubChem CID 58454753) has the molecular formula C20H40O6Si
and a molecular weight of 404.62 g/mol. Its IUPAC name is [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate.
Molecular Properties
| Compound Name | [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate |
| PubChem CID | 58454753 |
| Molecular Formula | C20H40O6Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate |
| SMILES | COCCCCC(=O)OCCCCC(=O)OCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O6Si/c1-20(2,3)27(5,6)26-17-11-16-25-19(22)13-8-10-15-24-18(21)12-7-9-14-23-4/h7-17H2,1-6H3 |
| InChIKey | PBYHFSQPQYIPCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate?
The IUPAC name of [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate (CID 58454753) is [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate.
What is the SMILES notation for [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate?
The canonical SMILES for [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate is COCCCCC(=O)OCCCCC(=O)OCCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate?
The InChIKey is PBYHFSQPQYIPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O6Si/c1-20(2,3)27(5,6)26-17-11-16-25-19(22)13-8-10-15-24-18(21)12-7-9-14-23-4/h7-17H2,1-6H3.
What are the key properties of [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate?
[5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate has a molecular weight of 404.62 g/mol, XLogP of 4.47, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-5-oxopentyl] 5-methoxypentanoate is sourced from PubChem (CID 58454753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).