C10H11NO2 — CID 58455619
4-ethyl-5-methyl-7H-pyrano[2,3-c]pyrrol-2-one (PubChem CID 58455619) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-ethyl-5-methyl-7H-pyrano[2,3-c]pyrrol-2-one.
| Compound Name | 4-ethyl-5-methyl-7H-pyrano[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 58455619 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-ethyl-5-methyl-7H-pyrano[2,3-c]pyrrol-2-one |
| SMILES | CCc1cc(=O)oc2c1C(C)=NC2 |
| InChI | InChI=1S/C10H11NO2/c1-3-7-4-9(12)13-8-5-11-6(2)10(7)8/h4H,3,5H2,1-2H3 |
| InChIKey | QMNMMBGQHITHGK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |