C14H9ClN2O3 — CID 58460041
3-[(4-acetyl-2-oxo-1H-pyridin-3-yl)oxy]-5-chlorobenzonitrile (PubChem CID 58460041) has the molecular formula C14H9ClN2O3 and a molecular weight of 288.69 g/mol. Its IUPAC name is 3-[(4-acetyl-2-oxo-1H-pyridin-3-yl)oxy]-5-chlorobenzonitrile.
| Compound Name | 3-[(4-acetyl-2-oxo-1H-pyridin-3-yl)oxy]-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 58460041 |
| Molecular Formula | C14H9ClN2O3 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-[(4-acetyl-2-oxo-1H-pyridin-3-yl)oxy]-5-chlorobenzonitrile |
| SMILES | CC(=O)c1cc[nH]c(=O)c1Oc1cc(Cl)cc(C#N)c1 |
| InChI | InChI=1S/C14H9ClN2O3/c1-8(18)12-2-3-17-14(19)13(12)20-11-5-9(7-16)4-10(15)6-11/h2-6H,1H3,(H,17,19) |
| InChIKey | GXWCVUKXEQPBJL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |