C11H18W — CID 58460573
(4Z)-3,4,5,6-tetramethylhepta-2,4-diene;tungsten(2+) (PubChem CID 58460573) has the molecular formula C11H18W and a molecular weight of 334.11 g/mol. Its IUPAC name is (4Z)-3,4,5,6-tetramethylhepta-2,4-diene;tungsten(2+).
| Compound Name | (4Z)-3,4,5,6-tetramethylhepta-2,4-diene;tungsten(2+) |
|---|---|
| PubChem CID | 58460573 |
| Molecular Formula | C11H18W |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (4Z)-3,4,5,6-tetramethylhepta-2,4-diene;tungsten(2+) |
| SMILES | C/[C-]=C(C)/C(C)=C(/C)[C-](C)C.[W+2] |
| InChI | InChI=1S/C11H18.W/c1-7-9(4)11(6)10(5)8(2)3;/h1-6H3;/q-2;+2/b11-10-; |
| InChIKey | PJYFHLANLZMBME-GMFCBQQYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|