C11H11ClN2 — CID 58461687
5-chloro-2-methylnaphthalene-1,8-diamine (PubChem CID 58461687) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 5-chloro-2-methylnaphthalene-1,8-diamine.
| Compound Name | 5-chloro-2-methylnaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 58461687 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-chloro-2-methylnaphthalene-1,8-diamine |
| SMILES | Cc1ccc2c(Cl)ccc(N)c2c1N |
| InChI | InChI=1S/C11H11ClN2/c1-6-2-3-7-8(12)4-5-9(13)10(7)11(6)14/h2-5H,13-14H2,1H3 |
| InChIKey | NDQGEIXJDNRLEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|