C42H48O2 — CID 58461816
2,8-ditert-butyl-4-[(E)-2-(2,8-ditert-butyldibenzofuran-4-yl)ethenyl]dibenzofuran (PubChem CID 58461816) has the molecular formula C42H48O2 and a molecular weight of 584.84 g/mol. Its IUPAC name is 2,8-ditert-butyl-4-[(E)-2-(2,8-ditert-butyldibenzofuran-4-yl)ethenyl]dibenzofuran.
| Compound Name | 2,8-ditert-butyl-4-[(E)-2-(2,8-ditert-butyldibenzofuran-4-yl)ethenyl]dibenzofuran |
|---|---|
| PubChem CID | 58461816 |
| Molecular Formula | C42H48O2 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | 2,8-ditert-butyl-4-[(E)-2-(2,8-ditert-butyldibenzofuran-4-yl)ethenyl]dibenzofuran |
| SMILES | CC(C)(C)c1ccc2oc3c(/C=C/c4cc(C(C)(C)C)cc5c4oc4ccc(C(C)(C)C)cc45)cc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C42H48O2/c1-39(2,3)27-15-17-35-31(21-27)33-23-29(41(7,8)9)19-25(37(33)43-35)13-14-26-20-30(42(10,11)12)24-34-32-22-28(40(4,5)6)16-18-36(32)44-38(26)34/h13-24H,1-12H3/b14-13+ |
| InChIKey | OQIUFNKRBURNKJ-BUHFOSPRSA-N |
| XLogP | 12.85 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|