C18H17N5 — CID 58466975
(5'-pyridin-3-ylspiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide (PubChem CID 58466975) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is (5'-pyridin-3-ylspiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide.
| Compound Name | (5'-pyridin-3-ylspiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide |
|---|---|
| PubChem CID | 58466975 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (5'-pyridin-3-ylspiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide |
| SMILES | N#CNC1=NCC2(CCc3cccc(-c4cccnc4)c3C2)N1 |
| InChI | InChI=1S/C18H17N5/c19-12-22-17-21-11-18(23-17)7-6-13-3-1-5-15(16(13)9-18)14-4-2-8-20-10-14/h1-5,8,10H,6-7,9,11H2,(H2,21,22,23) |
| InChIKey | JAYNYMFMIZYOGS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|