C13H13BrN4 — CID 58467168
(8'-bromospiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide (PubChem CID 58467168) has the molecular formula C13H13BrN4 and a molecular weight of 305.18 g/mol. Its IUPAC name is (8'-bromospiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide.
| Compound Name | (8'-bromospiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide |
|---|---|
| PubChem CID | 58467168 |
| Molecular Formula | C13H13BrN4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | (8'-bromospiro[1,4-dihydroimidazole-5,3'-2,4-dihydro-1H-naphthalene]-2-yl)cyanamide |
| SMILES | N#CNC1=NCC2(CCc3c(Br)cccc3C2)N1 |
| InChI | InChI=1S/C13H13BrN4/c14-11-3-1-2-9-6-13(5-4-10(9)11)7-16-12(18-13)17-8-15/h1-3H,4-7H2,(H2,16,17,18) |
| InChIKey | VLZGUSITCNAPGQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|