C11H14BrNO3 — CID 91335874
(2-amino-5-bromo-3,4-dihydro-1H-naphthalen-2-yl)methanetriol (PubChem CID 91335874) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is (2-amino-5-bromo-3,4-dihydro-1H-naphthalen-2-yl)methanetriol.
| Compound Name | (2-amino-5-bromo-3,4-dihydro-1H-naphthalen-2-yl)methanetriol |
|---|---|
| PubChem CID | 91335874 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (2-amino-5-bromo-3,4-dihydro-1H-naphthalen-2-yl)methanetriol |
| SMILES | NC1(C(O)(O)O)CCc2c(Br)cccc2C1 |
| InChI | InChI=1S/C11H14BrNO3/c12-9-3-1-2-7-6-10(13,11(14,15)16)5-4-8(7)9/h1-3,14-16H,4-6,13H2 |
| InChIKey | JHMHBLZTEAGMLY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|