C11H9BrO2 — CID 166068229
4-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxole] (PubChem CID 166068229) has the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. Its IUPAC name is 4-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxole].
| Compound Name | 4-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxole] |
|---|---|
| PubChem CID | 166068229 |
| Molecular Formula | C11H9BrO2 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 4-bromospiro[1,3-dihydroindene-2,2'-1,3-dioxole] |
| SMILES | Brc1cccc2c1CC1(C2)OC=CO1 |
| InChI | InChI=1S/C11H9BrO2/c12-10-3-1-2-8-6-11(7-9(8)10)13-4-5-14-11/h1-5H,6-7H2 |
| InChIKey | WHGMQZJTHUGFFF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |