C15H20ClF3N2O3 — CID 58467963
2-chloro-4-[(2R)-3-methyl-3-(oxan-2-yloxy)butan-2-yl]oxy-5-(trifluoromethyl)pyrimidine (PubChem CID 58467963) has the molecular formula C15H20ClF3N2O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is 2-chloro-4-[(2R)-3-methyl-3-(oxan-2-yloxy)butan-2-yl]oxy-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-chloro-4-[(2R)-3-methyl-3-(oxan-2-yloxy)butan-2-yl]oxy-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 58467963 |
| Molecular Formula | C15H20ClF3N2O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-chloro-4-[(2R)-3-methyl-3-(oxan-2-yloxy)butan-2-yl]oxy-5-(trifluoromethyl)pyrimidine |
| SMILES | C[C@@H](Oc1nc(Cl)ncc1C(F)(F)F)C(C)(C)OC1CCCCO1 |
| InChI | InChI=1S/C15H20ClF3N2O3/c1-9(14(2,3)24-11-6-4-5-7-22-11)23-12-10(15(17,18)19)8-20-13(16)21-12/h8-9,11H,4-7H2,1-3H3/t9-,11?/m1/s1 |
| InChIKey | LIPLGVYNDCOBIJ-BFHBGLAWSA-N |
| XLogP | 4.24 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |