C27H41N5O4S — CID 58483518
5-ethyl-2-[4-[2-(3-methoxypropyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine (PubChem CID 58483518) has the molecular formula C27H41N5O4S and a molecular weight of 531.72 g/mol. Its IUPAC name is 5-ethyl-2-[4-[2-(3-methoxypropyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine.
| Compound Name | 5-ethyl-2-[4-[2-(3-methoxypropyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 58483518 |
| Molecular Formula | C27H41N5O4S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 5-ethyl-2-[4-[2-(3-methoxypropyl)-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cnc(N2CCC(Oc3ccc(CN4CCN(S(C)(=O)=O)CC4)cc3CCCOC)CC2)nc1 |
| InChI | InChI=1S/C27H41N5O4S/c1-4-22-19-28-27(29-20-22)31-11-9-25(10-12-31)36-26-8-7-23(18-24(26)6-5-17-35-2)21-30-13-15-32(16-14-30)37(3,33)34/h7-8,18-20,25H,4-6,9-17,21H2,1-3H3 |
| InChIKey | HNVZKRHCQUPNEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|