C27H42N6O3 — CID 143877125
N-[4-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-3-(3-methoxypropyl)phenyl]methyl]piperazin-1-yl]-N-methylhydroxylamine (PubChem CID 143877125) has the molecular formula C27H42N6O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[4-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-3-(3-methoxypropyl)phenyl]methyl]piperazin-1-yl]-N-methylhydroxylamine.
| Compound Name | N-[4-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-3-(3-methoxypropyl)phenyl]methyl]piperazin-1-yl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 143877125 |
| Molecular Formula | C27H42N6O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | N-[4-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-3-(3-methoxypropyl)phenyl]methyl]piperazin-1-yl]-N-methylhydroxylamine |
| SMILES | CCc1cnc(N2CCC(Oc3ccc(CN4CCN(N(C)O)CC4)cc3CCCOC)CC2)nc1 |
| InChI | InChI=1S/C27H42N6O3/c1-4-22-19-28-27(29-20-22)32-11-9-25(10-12-32)36-26-8-7-23(18-24(26)6-5-17-35-3)21-31-13-15-33(16-14-31)30(2)34/h7-8,18-20,25,34H,4-6,9-17,21H2,1-3H3 |
| InChIKey | OSKHFJSGIADCIT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|