C12H18N2O — CID 58488084
cyclopent-3-en-1-yl(3,6-diazabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 58488084) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is cyclopent-3-en-1-yl(3,6-diazabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | cyclopent-3-en-1-yl(3,6-diazabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 58488084 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | cyclopent-3-en-1-yl(3,6-diazabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | O=C(C1CC=CC1)N1CC2CNC(C2)C1 |
| InChI | InChI=1S/C12H18N2O/c15-12(10-3-1-2-4-10)14-7-9-5-11(8-14)13-6-9/h1-2,9-11,13H,3-8H2 |
| InChIKey | JOYIUTFTOJKICT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|