C11H18N2O — CID 67130620
1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]pent-3-en-1-one (PubChem CID 67130620) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]pent-3-en-1-one.
| Compound Name | 1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]pent-3-en-1-one |
|---|---|
| PubChem CID | 67130620 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]pent-3-en-1-one |
| SMILES | CC=CCC(=O)N1C[C@@H]2CN[C@@H](C2)C1 |
| InChI | InChI=1S/C11H18N2O/c1-2-3-4-11(14)13-7-9-5-10(8-13)12-6-9/h2-3,9-10,12H,4-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | GWYDHKXHKZTRFV-UWVGGRQHSA-N |
| XLogP | 0.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|