C13H24N4O2 — CID 58488894
N'-[3-(1-methyl-3-oxo-5-propanoylpiperazin-2-yl)propyl]ethanimidamide (PubChem CID 58488894) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N'-[3-(1-methyl-3-oxo-5-propanoylpiperazin-2-yl)propyl]ethanimidamide.
| Compound Name | N'-[3-(1-methyl-3-oxo-5-propanoylpiperazin-2-yl)propyl]ethanimidamide |
|---|---|
| PubChem CID | 58488894 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N'-[3-(1-methyl-3-oxo-5-propanoylpiperazin-2-yl)propyl]ethanimidamide |
| SMILES | CCC(=O)C1CN(C)C(CCC/N=C(\C)N)C(=O)N1 |
| InChI | InChI=1S/C13H24N4O2/c1-4-12(18)10-8-17(3)11(13(19)16-10)6-5-7-15-9(2)14/h10-11H,4-8H2,1-3H3,(H2,14,15)(H,16,19) |
| InChIKey | YEKAUKLODSWBHC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|