About 3-methylhexa-1,5-diene;yttrium
3-methylhexa-1,5-diene;yttrium (PubChem CID 58489253) has the molecular formula C7H10Y-2
and a molecular weight of 183.06 g/mol. Its IUPAC name is 3-methylhexa-1,5-diene;yttrium.
Molecular Properties
| Compound Name | 3-methylhexa-1,5-diene;yttrium |
| PubChem CID | 58489253 |
| Molecular Formula | C7H10Y-2 |
| Molecular Weight | 183.06 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 3-methylhexa-1,5-diene;yttrium |
| SMILES | C=[C-]CC(C)[C-]=C.[Y] |
| InChI | InChI=1S/C7H10.Y/c1-4-6-7(3)5-2;/h7H,1-2,6H2,3H3;/q-2; |
| InChIKey | MWIXMNBKYNBRNC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhexa-1,5-diene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexa-1,5-diene;yttrium?
The IUPAC name of 3-methylhexa-1,5-diene;yttrium (CID 58489253) is 3-methylhexa-1,5-diene;yttrium.
What is the SMILES notation for 3-methylhexa-1,5-diene;yttrium?
The canonical SMILES for 3-methylhexa-1,5-diene;yttrium is C=[C-]CC(C)[C-]=C.[Y].
What is the InChIKey of 3-methylhexa-1,5-diene;yttrium?
The InChIKey is MWIXMNBKYNBRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.Y/c1-4-6-7(3)5-2;/h7H,1-2,6H2,3H3;/q-2;.
What are the key properties of 3-methylhexa-1,5-diene;yttrium?
3-methylhexa-1,5-diene;yttrium has a molecular weight of 183.06 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexa-1,5-diene;yttrium is sourced from PubChem (CID 58489253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).