C27H20N2O7 — CID 58490017
[4-[(2Z)-2-acetyloxyimino-6-ethyl-3-oxofuro[3,2-c]carbazole-9-carbonyl]phenyl] acetate (PubChem CID 58490017) has the molecular formula C27H20N2O7 and a molecular weight of 484.46 g/mol. Its IUPAC name is [4-[(2Z)-2-acetyloxyimino-6-ethyl-3-oxofuro[3,2-c]carbazole-9-carbonyl]phenyl] acetate.
| Compound Name | [4-[(2Z)-2-acetyloxyimino-6-ethyl-3-oxofuro[3,2-c]carbazole-9-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 58490017 |
| Molecular Formula | C27H20N2O7 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [4-[(2Z)-2-acetyloxyimino-6-ethyl-3-oxofuro[3,2-c]carbazole-9-carbonyl]phenyl] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccc(OC(C)=O)cc3)cc2c2c3c(ccc21)C(=O)/C(=N/OC(C)=O)O3 |
| InChI | InChI=1S/C27H20N2O7/c1-4-29-21-11-7-17(24(32)16-5-8-18(9-6-16)34-14(2)30)13-20(21)23-22(29)12-10-19-25(33)27(35-26(19)23)28-36-15(3)31/h5-13H,4H2,1-3H3/b28-27- |
| InChIKey | OVNJHINLYCTWBS-DQSJHHFOSA-N |
| XLogP | 4.42 |
| TPSA | 113.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|