C30H28N2O5 — CID 58490084
[(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxopyrano[3,2-c]carbazol-3-ylidene]amino] pentanoate (PubChem CID 58490084) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is [(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxopyrano[3,2-c]carbazol-3-ylidene]amino] pentanoate.
| Compound Name | [(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxopyrano[3,2-c]carbazol-3-ylidene]amino] pentanoate |
|---|---|
| PubChem CID | 58490084 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxopyrano[3,2-c]carbazol-3-ylidene]amino] pentanoate |
| SMILES | CCCCC(=O)O/N=C1\COc2c(ccc3c2c2cc(C(=O)c4ccccc4C)ccc2n3CC)C1=O |
| InChI | InChI=1S/C30H28N2O5/c1-4-6-11-26(33)37-31-23-17-36-30-21(29(23)35)13-15-25-27(30)22-16-19(12-14-24(22)32(25)5-2)28(34)20-10-8-7-9-18(20)3/h7-10,12-16H,4-6,11,17H2,1-3H3/b31-23+ |
| InChIKey | RJJDXGRWBRMSIU-UQRQXUALSA-N |
| XLogP | 6.02 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|