C36H41N3O5 — CID 88858045
[(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 2-methyl-2-[methyl(pentyl)amino]propanoate (PubChem CID 88858045) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is [(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 2-methyl-2-[methyl(pentyl)amino]propanoate.
| Compound Name | [(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 2-methyl-2-[methyl(pentyl)amino]propanoate |
|---|---|
| PubChem CID | 88858045 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | [(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 2-methyl-2-[methyl(pentyl)amino]propanoate |
| SMILES | CCCCCN(C)C(C)(C)C(=O)O/N=C1\CCOc2c(ccc3c2c2cc(C(=O)c4ccccc4C)ccc2n3CC)C1=O |
| InChI | InChI=1S/C36H41N3O5/c1-7-9-12-20-38(6)36(4,5)35(42)44-37-28-19-21-43-34-26(33(28)41)16-18-30-31(34)27-22-24(15-17-29(27)39(30)8-2)32(40)25-14-11-10-13-23(25)3/h10-11,13-18,22H,7-9,12,19-21H2,1-6H3/b37-28+ |
| InChIKey | YDQINGMJJHPFNY-PNFNHJRFSA-N |
| XLogP | 7.12 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|