C33H28N2O6S — CID 58489996
[(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 58489996) has the molecular formula C33H28N2O6S and a molecular weight of 580.66 g/mol. Its IUPAC name is [(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58489996 |
| Molecular Formula | C33H28N2O6S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [(E)-[12-ethyl-16-(2-methylbenzoyl)-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2c3c(ccc21)C(=O)/C(=N/OS(=O)(=O)c1ccc(C)cc1)CCO3 |
| InChI | InChI=1S/C33H28N2O6S/c1-4-35-28-15-11-22(31(36)24-8-6-5-7-21(24)3)19-26(28)30-29(35)16-14-25-32(37)27(17-18-40-33(25)30)34-41-42(38,39)23-12-9-20(2)10-13-23/h5-16,19H,4,17-18H2,1-3H3/b34-27+ |
| InChIKey | GXTOZLPAMSCHND-DNGXXSEMSA-N |
| XLogP | 6.39 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|