C26H22N2O3 — CID 142712093
3-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4,5-dihydrooxazin-6-one (PubChem CID 142712093) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4,5-dihydrooxazin-6-one.
| Compound Name | 3-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4,5-dihydrooxazin-6-one |
|---|---|
| PubChem CID | 142712093 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-4,5-dihydrooxazin-6-one |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(C3=NOC(=O)CC3)ccc21 |
| InChI | InChI=1S/C26H22N2O3/c1-3-28-23-11-8-17(22-10-13-25(29)31-27-22)14-20(23)21-15-18(9-12-24(21)28)26(30)19-7-5-4-6-16(19)2/h4-9,11-12,14-15H,3,10,13H2,1-2H3 |
| InChIKey | QSOHSMBHQPJLKP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|