C35H25F5N2O5S — CID 172955004
[(Z)-[3-cyclopentylidene-6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 172955004) has the molecular formula C35H25F5N2O5S and a molecular weight of 680.65 g/mol. Its IUPAC name is [(Z)-[3-cyclopentylidene-6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [(Z)-[3-cyclopentylidene-6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 172955004 |
| Molecular Formula | C35H25F5N2O5S |
| Molecular Weight | 680.65 g/mol |
| Exact Mass | 680.14 |
| IUPAC Name | [(Z)-[3-cyclopentylidene-6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-2-ylidene]amino] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2c3c(ccc21)C(=C1CCCC1)/C(=N/OS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)O3 |
| InChI | InChI=1S/C35H25F5N2O5S/c1-3-42-23-14-12-19(32(43)20-11-7-4-8-17(20)2)16-22(23)26-24(42)15-13-21-25(18-9-5-6-10-18)35(46-33(21)26)41-47-48(44,45)34-30(39)28(37)27(36)29(38)31(34)40/h4,7-8,11-16H,3,5-6,9-10H2,1-2H3/b41-35- |
| InChIKey | ABAKFIQGKWOYEW-LCNSVZBRSA-N |
| XLogP | 8.49 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|