C29H26N2O5 — CID 89105009
[(Z)-[6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-3-ylidene]amino] oxolane-2-carboxylate (PubChem CID 89105009) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is [(Z)-[6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-3-ylidene]amino] oxolane-2-carboxylate.
| Compound Name | [(Z)-[6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-3-ylidene]amino] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 89105009 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | [(Z)-[6-ethyl-9-(2-methylbenzoyl)furo[3,2-c]carbazol-3-ylidene]amino] oxolane-2-carboxylate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2c3c(ccc21)/C(=N/OC(=O)C1CCCO1)CO3 |
| InChI | InChI=1S/C29H26N2O5/c1-3-31-23-12-10-18(27(32)19-8-5-4-7-17(19)2)15-21(23)26-24(31)13-11-20-22(16-35-28(20)26)30-36-29(33)25-9-6-14-34-25/h4-5,7-8,10-13,15,25H,3,6,9,14,16H2,1-2H3/b30-22+ |
| InChIKey | ORYIBJAHKPFCRC-JBASAIQMSA-N |
| XLogP | 5.17 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|