C22H21BrN2O2 — CID 58490735
benzyl (2R)-2-[4-(4-bromophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58490735) has the molecular formula C22H21BrN2O2 and a molecular weight of 425.33 g/mol. Its IUPAC name is benzyl (2R)-2-[4-(4-bromophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[4-(4-bromophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58490735 |
| Molecular Formula | C22H21BrN2O2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | benzyl (2R)-2-[4-(4-bromophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@H]1C1=NC=C(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C22H21BrN2O2/c23-19-10-8-17(9-11-19)18-13-20(24-14-18)21-7-4-12-25(21)22(26)27-15-16-5-2-1-3-6-16/h1-3,5-6,8-11,14,21H,4,7,12-13,15H2/t21-/m1/s1 |
| InChIKey | YJRYEYNFCZEUKN-OAQYLSRUSA-N |
| XLogP | 5.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |