C19H28FN3O7S — CID 58492734
S-[8-(hydroxyamino)-8-oxooctyl] 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]ethanethioate (PubChem CID 58492734) has the molecular formula C19H28FN3O7S and a molecular weight of 461.51 g/mol. Its IUPAC name is S-[8-(hydroxyamino)-8-oxooctyl] 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]ethanethioate.
| Compound Name | S-[8-(hydroxyamino)-8-oxooctyl] 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]ethanethioate |
|---|---|
| PubChem CID | 58492734 |
| Molecular Formula | C19H28FN3O7S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | S-[8-(hydroxyamino)-8-oxooctyl] 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]ethanethioate |
| SMILES | C[C@H]1O[C@@H](n2cc(F)c(CC(=O)SCCCCCCCC(=O)NO)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H28FN3O7S/c1-11-16(26)17(27)18(30-11)23-10-12(20)13(21-19(23)28)9-15(25)31-8-6-4-2-3-5-7-14(24)22-29/h10-11,16-18,26-27,29H,2-9H2,1H3,(H,22,24)/t11-,16-,17-,18-/m1/s1 |
| InChIKey | KYBGMNRFMDTEJO-INXYXQHBSA-N |
| XLogP | 0.67 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|