C36H32N2 — CID 58501433
5,11,11-trimethyl-N,N-bis(4-methylphenyl)indeno[1,2-b]carbazol-9-amine (PubChem CID 58501433) has the molecular formula C36H32N2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 5,11,11-trimethyl-N,N-bis(4-methylphenyl)indeno[1,2-b]carbazol-9-amine.
| Compound Name | 5,11,11-trimethyl-N,N-bis(4-methylphenyl)indeno[1,2-b]carbazol-9-amine |
|---|---|
| PubChem CID | 58501433 |
| Molecular Formula | C36H32N2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 5,11,11-trimethyl-N,N-bis(4-methylphenyl)indeno[1,2-b]carbazol-9-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C(C)(C)c2cc4c5ccccc5n(C)c4cc2-3)cc1 |
| InChI | InChI=1S/C36H32N2/c1-23-10-14-25(15-11-23)38(26-16-12-24(2)13-17-26)27-18-19-28-30-22-35-31(21-33(30)36(3,4)32(28)20-27)29-8-6-7-9-34(29)37(35)5/h6-22H,1-5H3 |
| InChIKey | ODZOFXAIYWYRRK-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |