C55H53N3Si2 — CID 58511481
N-phenyl-N-(3-trimethylsilylphenyl)-6-[4-[(E)-2-[4-[4-(N-(3-trimethylsilylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]pyridin-3-amine (PubChem CID 58511481) has the molecular formula C55H53N3Si2 and a molecular weight of 812.22 g/mol. Its IUPAC name is N-phenyl-N-(3-trimethylsilylphenyl)-6-[4-[(E)-2-[4-[4-(N-(3-trimethylsilylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]pyridin-3-amine.
| Compound Name | N-phenyl-N-(3-trimethylsilylphenyl)-6-[4-[(E)-2-[4-[4-(N-(3-trimethylsilylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 58511481 |
| Molecular Formula | C55H53N3Si2 |
| Molecular Weight | 812.22 g/mol |
| Exact Mass | 811.38 |
| IUPAC Name | N-phenyl-N-(3-trimethylsilylphenyl)-6-[4-[(E)-2-[4-[4-(N-(3-trimethylsilylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]pyridin-3-amine |
| SMILES | C[Si](C)(C)c1cccc(N(c2ccccc2)c2ccc(-c3ccc(/C=C/c4ccc(-c5ccc(N(c6ccccc6)c6cccc([Si](C)(C)C)c6)cn5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C55H53N3Si2/c1-59(2,3)53-21-13-19-50(39-53)57(47-15-9-7-10-16-47)49-35-33-45(34-36-49)44-29-25-42(26-30-44)23-24-43-27-31-46(32-28-43)55-38-37-52(41-56-55)58(48-17-11-8-12-18-48)51-20-14-22-54(40-51)60(4,5)6/h7-41H,1-6H3/b24-23+ |
| InChIKey | ZTWGDOFEJZYZDK-WCWDXBQESA-N |
| XLogP | 14.62 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.22 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|