C33H49N3Si — CID 58512385
3-(1-methylpiperidin-4-yl)-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-tri(propan-2-yl)silylindol-6-amine (PubChem CID 58512385) has the molecular formula C33H49N3Si and a molecular weight of 515.86 g/mol. Its IUPAC name is 3-(1-methylpiperidin-4-yl)-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-tri(propan-2-yl)silylindol-6-amine.
| Compound Name | 3-(1-methylpiperidin-4-yl)-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-tri(propan-2-yl)silylindol-6-amine |
|---|---|
| PubChem CID | 58512385 |
| Molecular Formula | C33H49N3Si |
| Molecular Weight | 515.86 g/mol |
| Exact Mass | 515.37 |
| IUPAC Name | 3-(1-methylpiperidin-4-yl)-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-1-tri(propan-2-yl)silylindol-6-amine |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(C2CCN(C)CC2)c2ccc(Nc3ccc4c(c3)CCCC4)cc21 |
| InChI | InChI=1S/C33H49N3Si/c1-23(2)37(24(3)4,25(5)6)36-22-32(27-16-18-35(7)19-17-27)31-15-14-30(21-33(31)36)34-29-13-12-26-10-8-9-11-28(26)20-29/h12-15,20-25,27,34H,8-11,16-19H2,1-7H3 |
| InChIKey | UZMCSZMOARZIPF-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.86 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|