C8H21N3 — CID 58512733
1-N',3-N-dimethyl-3-N-propylpropane-1,1,3-triamine (PubChem CID 58512733) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is 1-N',3-N-dimethyl-3-N-propylpropane-1,1,3-triamine.
| Compound Name | 1-N',3-N-dimethyl-3-N-propylpropane-1,1,3-triamine |
|---|---|
| PubChem CID | 58512733 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | 1-N',3-N-dimethyl-3-N-propylpropane-1,1,3-triamine |
| SMILES | CCCN(C)CCC(N)NC |
| InChI | InChI=1S/C8H21N3/c1-4-6-11(3)7-5-8(9)10-2/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | CRYGWACBBSUPNI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|