About iridium;pyrido[2,3-a]carbazol-11-ide
iridium;pyrido[2,3-a]carbazol-11-ide (PubChem CID 58517833) has the molecular formula C15H9IrN2-
and a molecular weight of 409.47 g/mol. Its IUPAC name is iridium;pyrido[2,3-a]carbazol-11-ide.
Molecular Properties
| Compound Name | iridium;pyrido[2,3-a]carbazol-11-ide |
| PubChem CID | 58517833 |
| Molecular Formula | C15H9IrN2- |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | iridium;pyrido[2,3-a]carbazol-11-ide |
| SMILES | [Ir].c1cnc2c(c1)ccc1c3ccccc3[n-]c12 |
| InChI | InChI=1S/C15H9N2.Ir/c1-2-6-13-11(5-1)12-8-7-10-4-3-9-16-14(10)15(12)17-13;/h1-9H;/q-1; |
| InChIKey | AWTPYYXDUZEXHL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze iridium;pyrido[2,3-a]carbazol-11-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;pyrido[2,3-a]carbazol-11-ide?
The IUPAC name of iridium;pyrido[2,3-a]carbazol-11-ide (CID 58517833) is iridium;pyrido[2,3-a]carbazol-11-ide.
What is the SMILES notation for iridium;pyrido[2,3-a]carbazol-11-ide?
The canonical SMILES for iridium;pyrido[2,3-a]carbazol-11-ide is [Ir].c1cnc2c(c1)ccc1c3ccccc3[n-]c12.
What is the InChIKey of iridium;pyrido[2,3-a]carbazol-11-ide?
The InChIKey is AWTPYYXDUZEXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N2.Ir/c1-2-6-13-11(5-1)12-8-7-10-4-3-9-16-14(10)15(12)17-13;/h1-9H;/q-1;.
What are the key properties of iridium;pyrido[2,3-a]carbazol-11-ide?
iridium;pyrido[2,3-a]carbazol-11-ide has a molecular weight of 409.47 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;pyrido[2,3-a]carbazol-11-ide is sourced from PubChem (CID 58517833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).