C56H42N2O4S — CID 58520094
[4-[4-[N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-4-(4-phenothiazin-10-ylphenyl)anilino]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 58520094) has the molecular formula C56H42N2O4S and a molecular weight of 839.03 g/mol. Its IUPAC name is [4-[4-[N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-4-(4-phenothiazin-10-ylphenyl)anilino]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-4-(4-phenothiazin-10-ylphenyl)anilino]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58520094 |
| Molecular Formula | C56H42N2O4S |
| Molecular Weight | 839.03 g/mol |
| Exact Mass | 838.29 |
| IUPAC Name | [4-[4-[N-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]-4-(4-phenothiazin-10-ylphenyl)anilino]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(N(c3ccc(-c4ccc(OC(=O)C(=C)C)cc4)cc3)c3ccc(-c4ccc(N5c6ccccc6Sc6ccccc65)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H42N2O4S/c1-37(2)55(59)61-49-33-21-43(22-34-49)41-15-27-46(28-16-41)57(47-29-17-42(18-30-47)44-23-35-50(36-24-44)62-56(60)38(3)4)45-25-13-39(14-26-45)40-19-31-48(32-20-40)58-51-9-5-7-11-53(51)63-54-12-8-6-10-52(54)58/h5-36H,1,3H2,2,4H3 |
| InChIKey | DZBYLMWHJJJTBN-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.03 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|