C21H21ClF2N4O2S — CID 58523719
4-[3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-3-yl]prop-2-ynyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 58523719) has the molecular formula C21H21ClF2N4O2S and a molecular weight of 466.94 g/mol. Its IUPAC name is 4-[3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-3-yl]prop-2-ynyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-3-yl]prop-2-ynyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 58523719 |
| Molecular Formula | C21H21ClF2N4O2S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 4-[3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-3-yl]prop-2-ynyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(CC#Cc2cnc3c(n2)N(Cc2c(F)ccc(F)c2Cl)CCC3)CC1 |
| InChI | InChI=1S/C21H21ClF2N4O2S/c22-20-16(17(23)5-6-18(20)24)14-28-8-2-4-19-21(28)26-15(13-25-19)3-1-7-27-9-11-31(29,30)12-10-27/h5-6,13H,2,4,7-12,14H2 |
| InChIKey | HZWUUSMPQJQEQQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|