C27H35NO11 — CID 58526264
ethyl 6-[[2-[7-[6-(formyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylidenechromen-4-yl]acetyl]amino]hexanoate (PubChem CID 58526264) has the molecular formula C27H35NO11 and a molecular weight of 549.57 g/mol. Its IUPAC name is ethyl 6-[[2-[7-[6-(formyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylidenechromen-4-yl]acetyl]amino]hexanoate.
| Compound Name | ethyl 6-[[2-[7-[6-(formyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylidenechromen-4-yl]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 58526264 |
| Molecular Formula | C27H35NO11 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | ethyl 6-[[2-[7-[6-(formyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylidenechromen-4-yl]acetyl]amino]hexanoate |
| SMILES | C=C1C=C(CC(=O)NCCCCCC(=O)OCC)c2ccc(OC3OC(COC=O)C(O)C(O)C3O)cc2O1 |
| InChI | InChI=1S/C27H35NO11/c1-3-36-23(31)7-5-4-6-10-28-22(30)12-17-11-16(2)37-20-13-18(8-9-19(17)20)38-27-26(34)25(33)24(32)21(39-27)14-35-15-29/h8-9,11,13,15,21,24-27,32-34H,2-7,10,12,14H2,1H3,(H,28,30) |
| InChIKey | UYJLZBWXOFOGAA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 170.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|