C25H31NNa2O12S — CID 58526267
disodium;[2-[4-[2-[(6-ethoxy-6-oxohexyl)amino]-2-oxoethyl]-2-methylidenechromen-7-yl]oxy-4,5-dihydroxy-3,4,5,6-tetrahydro-2H-pyran-6-id-3-yl] sulfate (PubChem CID 58526267) has the molecular formula C25H31NNa2O12S and a molecular weight of 615.57 g/mol. Its IUPAC name is disodium;[2-[4-[2-[(6-ethoxy-6-oxohexyl)amino]-2-oxoethyl]-2-methylidenechromen-7-yl]oxy-4,5-dihydroxy-3,4,5,6-tetrahydro-2H-pyran-6-id-3-yl] sulfate.
| Compound Name | disodium;[2-[4-[2-[(6-ethoxy-6-oxohexyl)amino]-2-oxoethyl]-2-methylidenechromen-7-yl]oxy-4,5-dihydroxy-3,4,5,6-tetrahydro-2H-pyran-6-id-3-yl] sulfate |
|---|---|
| PubChem CID | 58526267 |
| Molecular Formula | C25H31NNa2O12S |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | disodium;[2-[4-[2-[(6-ethoxy-6-oxohexyl)amino]-2-oxoethyl]-2-methylidenechromen-7-yl]oxy-4,5-dihydroxy-3,4,5,6-tetrahydro-2H-pyran-6-id-3-yl] sulfate |
| SMILES | C=C1C=C(CC(=O)NCCCCCC(=O)OCC)c2ccc(OC3O[CH-]C(O)C(O)C3OS(=O)(=O)[O-])cc2O1.[Na+].[Na+] |
| InChI | InChI=1S/C25H32NO12S.2Na/c1-3-34-22(29)7-5-4-6-10-26-21(28)12-16-11-15(2)36-20-13-17(8-9-18(16)20)37-25-24(38-39(31,32)33)23(30)19(27)14-35-25;;/h8-9,11,13-14,19,23-25,27,30H,2-7,10,12H2,1H3,(H,26,28)(H,31,32,33);;/q-1;2*+1/p-1 |
| InChIKey | CFAVNWSJYHONDD-UHFFFAOYSA-M |
| XLogP | -4.92 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|