methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate

C14H16BrNO3 — CID 58539672

IUPACmethyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate
SMILESC/N=C(\C)C(C(=O)OC)C(=O)c1ccc(Br)c(C)c1
InChIInChI=1S/C14H16BrNO3/c1-8-7-10(5-6-11(8)15)13(17)12(9(2)16-3)14(18)19-4/h5-7,12H,1-4H3/b16-9+
InChIKeyPGDOCPVCNDDRNU-CXUHLZMHSA-N
MW326.19 g/mol
LogP2.82
Rot. Bonds4

About methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate

methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate (PubChem CID 58539672) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate.

Molecular Properties

Compound Namemethyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate
PubChem CID58539672
Molecular FormulaC14H16BrNO3
Molecular Weight326.19 g/mol
Exact Mass325.03
IUPAC Namemethyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate
SMILESC/N=C(\C)C(C(=O)OC)C(=O)c1ccc(Br)c(C)c1
InChIInChI=1S/C14H16BrNO3/c1-8-7-10(5-6-11(8)15)13(17)12(9(2)16-3)14(18)19-4/h5-7,12H,1-4H3/b16-9+
InChIKeyPGDOCPVCNDDRNU-CXUHLZMHSA-N
XLogP2.82
TPSA55.73 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.19
LogP ≤ 52.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate?
The IUPAC name of methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate (CID 58539672) is methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate.
What is the SMILES notation for methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate?
The canonical SMILES for methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate is C/N=C(\C)C(C(=O)OC)C(=O)c1ccc(Br)c(C)c1.
What is the InChIKey of methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate?
The InChIKey is PGDOCPVCNDDRNU-CXUHLZMHSA-N. The full InChI is InChI=1S/C14H16BrNO3/c1-8-7-10(5-6-11(8)15)13(17)12(9(2)16-3)14(18)19-4/h5-7,12H,1-4H3/b16-9+.
What are the key properties of methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate?
methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate has a molecular weight of 326.19 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-bromo-3-methylbenzoyl)-3-methyliminobutanoate is sourced from PubChem (CID 58539672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).