C25H26FNO6S — CID 58541164
1-[2-[3-[2-(2,3-dimethoxyphenoxy)-5-fluorophenyl]-2-oxopropyl]-1,3-thiazol-4-yl]-4-methoxybutan-1-one (PubChem CID 58541164) has the molecular formula C25H26FNO6S and a molecular weight of 487.55 g/mol. Its IUPAC name is 1-[2-[3-[2-(2,3-dimethoxyphenoxy)-5-fluorophenyl]-2-oxopropyl]-1,3-thiazol-4-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[3-[2-(2,3-dimethoxyphenoxy)-5-fluorophenyl]-2-oxopropyl]-1,3-thiazol-4-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 58541164 |
| Molecular Formula | C25H26FNO6S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 1-[2-[3-[2-(2,3-dimethoxyphenoxy)-5-fluorophenyl]-2-oxopropyl]-1,3-thiazol-4-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1csc(CC(=O)Cc2cc(F)ccc2Oc2cccc(OC)c2OC)n1 |
| InChI | InChI=1S/C25H26FNO6S/c1-30-11-5-6-20(29)19-15-34-24(27-19)14-18(28)13-16-12-17(26)9-10-21(16)33-23-8-4-7-22(31-2)25(23)32-3/h4,7-10,12,15H,5-6,11,13-14H2,1-3H3 |
| InChIKey | HUPKRGYLGJNPOB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|