C37H47N3Pt — CID 58544580
CID 58544580 (PubChem CID 58544580) has the molecular formula C37H47N3Pt and a molecular weight of 728.88 g/mol.
| Compound Name | CID 58544580 |
|---|---|
| PubChem CID | 58544580 |
| Molecular Formula | C37H47N3Pt |
| Molecular Weight | 728.88 g/mol |
| Exact Mass | 728.34 |
| IUPAC Name | — |
| SMILES | CCC1=C(CC)/C2=C/C3=C(CC)C(CC)C(/C=C4\N=C(/C=c5\[cH-]/c(c(CC)c5CC)=C\C1=N2)C(CC)=C4CC)[N-]3.[Pt+2] |
| InChI | InChI=1S/C37H47N3.Pt/c1-9-24-22-17-23(25(24)10-2)19-33-27(12-4)29(14-6)35(39-33)21-37-31(16-8)30(15-7)36(40-37)20-34-28(13-5)26(11-3)32(18-22)38-34;/h17-21,30,36H,9-16H2,1-8H3;/q-2;+2/b22-18+,23-19+,34-20-,35-21-; |
| InChIKey | ACFWUOUCPCHVFR-GLPDEDDGSA-N |
| XLogP | 8.46 |
| TPSA | 38.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.88 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|