C36H46N4Pt — CID 168743762
(5Z,10Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-1,20-dihydroporphyrin;platinum (PubChem CID 168743762) has the molecular formula C36H46N4Pt and a molecular weight of 729.87 g/mol. Its IUPAC name is (5Z,10Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-1,20-dihydroporphyrin;platinum.
| Compound Name | (5Z,10Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-1,20-dihydroporphyrin;platinum |
|---|---|
| PubChem CID | 168743762 |
| Molecular Formula | C36H46N4Pt |
| Molecular Weight | 729.87 g/mol |
| Exact Mass | 729.34 |
| IUPAC Name | (5Z,10Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-1,20-dihydroporphyrin;platinum |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=NC(CC5=N/C(=C\C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC.[Pt] |
| InChI | InChI=1S/C36H46N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-19,34H,9-16,20H2,1-8H3;/b30-18-,31-17-,35-19-; |
| InChIKey | WKSIMRMZAXCQGB-NUJIRDDASA-N |
| XLogP | 9.69 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.87 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |