C25H29ClN4O — CID 58549596
[(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethanone (PubChem CID 58549596) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is [(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethanone.
| Compound Name | [(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethanone |
|---|---|
| PubChem CID | 58549596 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [(3'S,5R)-2-chlorospiro[7,8-dihydro-6H-quinoline-5,4'-pyrrolidine]-3'-yl]-spiro[1,2-dihydroindole-3,4'-piperidine]-1'-ylmethanone |
| SMILES | O=C([C@@H]1CNC[C@]12CCCc1nc(Cl)ccc12)N1CCC2(CC1)CNc1ccccc12 |
| InChI | InChI=1S/C25H29ClN4O/c26-22-8-7-18-21(29-22)6-3-9-25(18)16-27-14-19(25)23(31)30-12-10-24(11-13-30)15-28-20-5-2-1-4-17(20)24/h1-2,4-5,7-8,19,27-28H,3,6,9-16H2/t19-,25-/m0/s1 |
| InChIKey | YXGGDDKPQSEWRM-DFBJGRDBSA-N |
| XLogP | 3.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|