C31H28N2O5 — CID 58556729
1,5-diamino-2-(4-butoxyphenyl)-4,8-dihydroxy-6-(4-methylphenyl)anthracene-9,10-dione (PubChem CID 58556729) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 1,5-diamino-2-(4-butoxyphenyl)-4,8-dihydroxy-6-(4-methylphenyl)anthracene-9,10-dione.
| Compound Name | 1,5-diamino-2-(4-butoxyphenyl)-4,8-dihydroxy-6-(4-methylphenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 58556729 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 1,5-diamino-2-(4-butoxyphenyl)-4,8-dihydroxy-6-(4-methylphenyl)anthracene-9,10-dione |
| SMILES | CCCCOc1ccc(-c2cc(O)c3c(c2N)C(=O)c2c(O)cc(-c4ccc(C)cc4)c(N)c2C3=O)cc1 |
| InChI | InChI=1S/C31H28N2O5/c1-3-4-13-38-19-11-9-18(10-12-19)21-15-23(35)25-27(29(21)33)31(37)24-22(34)14-20(28(32)26(24)30(25)36)17-7-5-16(2)6-8-17/h5-12,14-15,34-35H,3-4,13,32-33H2,1-2H3 |
| InChIKey | CYCXRYWAPXBDRY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|